CymitQuimica logo

CAS 714282-41-4

:

3-chloro-2-(4-ethylpiperazin-1-yl)aniline

Description:
3-Chloro-2-(4-ethylpiperazin-1-yl)aniline is an organic compound characterized by its aromatic amine structure, which includes a chloro substituent and a piperazine moiety. The presence of the chloro group at the meta position relative to the amino group contributes to its reactivity and potential applications in medicinal chemistry. The piperazine ring, which is a six-membered saturated heterocycle containing two nitrogen atoms, enhances the compound's pharmacological properties, making it of interest in drug development. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino and piperazine functional groups. Its molecular structure suggests potential interactions with biological targets, which could be explored in the context of therapeutic applications. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity and environmental impact. Overall, 3-chloro-2-(4-ethylpiperazin-1-yl)aniline represents a versatile scaffold for further chemical modifications and investigations in various fields, including pharmaceuticals and agrochemicals.
Formula:C12H18ClN3
InChI:InChI=1/C12H18ClN3/c1-2-15-6-8-16(9-7-15)12-10(13)4-3-5-11(12)14/h3-5H,2,6-9,14H2,1H3
SMILES:CCN1CCN(CC1)c1c(cccc1N)Cl
Synonyms:
  • Benzenamine, 3-Chloro-2-(4-Ethyl-1-Piperazinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.