CAS 7143-09-1
:(-)-Ecgonine methyl ester
Description:
(-)-Ecgonine methyl ester is a chemical compound that belongs to the class of tropane alkaloids, specifically derived from ecgonine, which is a precursor to cocaine. It is characterized by its molecular structure, which includes a methyl ester functional group attached to the ecgonine backbone. This compound is typically a white crystalline solid and is soluble in organic solvents such as ethanol and chloroform, but has limited solubility in water. The compound exhibits a specific optical activity, as indicated by its designation as "(-)", which refers to its levorotatory nature, meaning it rotates plane-polarized light to the left. (-)-Ecgonine methyl ester is of interest in various fields, including medicinal chemistry and pharmacology, due to its potential biological activities and its role in the synthesis of other tropane derivatives. Safety and handling precautions are essential when working with this compound, as it may have toxicological effects similar to other alkaloids.
Formula:C10H17NO3
InChI:InChI=1S/C10H17NO3/c1-11-6-3-4-7(11)9(8(12)5-6)10(13)14-2/h6-9,12H,3-5H2,1-2H3/t6-,7+,8-,9+/m0/s1
InChI key:InChIKey=QIQNNBXHAYSQRY-UYXSQOIJSA-N
SMILES:C(OC)(=O)[C@@H]1[C@@]2(N(C)[C@@](CC2)(C[C@@H]1O)[H])[H]
Synonyms:- (-)-Ecognine methyl ester
- 1α<span class="text-smallcaps">H</smallcap>,5α<smallcap>H</span>-Tropane-2β-carboxylic acid, 3β-hydroxy-, methyl ester
- 8-Azabicyclo[3.2.1]octane-2-carboxylic acid, 3-hydroxy-8-methyl-, methyl ester, [1R-(exo,exo)]-
- 8-azabicyclo[3.2.1]octane-2-carboxylic acid, 3-hydroxy-8-methyl-, methyl ester, (1R,2R,3S,5S)-
- Ecgonine Methyl Ester
- Methylecgonine
- 1αH,5αH-Tropane-2β-carboxylic acid, 3β-hydroxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Ecgonine Methyl Ester 1.0 mg/ml in Acetonitrile
CAS:Controlled ProductColor and Shape:Single SolutionEcgonine Methyl Ester
CAS:Controlled ProductFormula:C10H17NO3Color and Shape:NeatMolecular weight:199.25

