CAS 71434-47-4
:1-Chloro-7-phenylheptane
Description:
1-Chloro-7-phenylheptane is an organic compound characterized by its structure, which includes a heptane backbone with a chlorine atom and a phenyl group attached. The presence of the chlorine atom introduces polar characteristics, which can influence its reactivity and solubility in various solvents. This compound is typically a colorless to pale yellow liquid, exhibiting moderate volatility. Its molecular structure suggests that it may participate in nucleophilic substitution reactions due to the presence of the chlorine atom, making it a potential intermediate in organic synthesis. The phenyl group contributes to the compound's hydrophobic nature, affecting its interactions with other molecules. Additionally, 1-chloro-7-phenylheptane may exhibit certain physical properties such as boiling and melting points that are influenced by the length of the carbon chain and the presence of the phenyl group. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound is of interest in both academic research and industrial applications, particularly in the synthesis of more complex organic molecules.
Formula:C13H19Cl
InChI:InChI=1/C13H19Cl/c14-12-8-3-1-2-5-9-13-10-6-4-7-11-13/h4,6-7,10-11H,1-3,5,8-9,12H2
SMILES:C(CCCc1ccccc1)CCCCl
Synonyms:- 7-Phenyl-n-heptyl chloride
- (7-Chloroheptyl)Benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


