CAS 71436-90-3
:Boron, (methanol)trimethoxy-, (T-4)-
Description:
Boron, (methanol)trimethoxy-, (T-4)-, with the CAS number 71436-90-3, is an organoboron compound characterized by the presence of boron bonded to three methoxy groups and one methanol group. This compound typically exhibits properties associated with organoboron chemistry, such as reactivity in nucleophilic substitution reactions and potential applications in organic synthesis and materials science. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and stability. Organoboron compounds like this one are often utilized in various fields, including catalysis, pharmaceuticals, and as intermediates in organic synthesis. Additionally, the trimethoxy structure suggests that it may participate in reactions that involve the cleavage of the methoxy groups, leading to the formation of boron-containing intermediates. Overall, this compound exemplifies the versatility of boron in organic chemistry, particularly in the development of functional materials and chemical synthesis pathways.
Formula:C4H13BO4
InChI:InChI=1S/C4H13BO4/c1-6-5(7-2,8-3)9-4/h6H,1-4H3
InChI key:InChIKey=GAYDHJXPMRZAIS-UHFFFAOYSA-N
SMILES:[B+3]([O-]C)([O-]C)([O-]C)[OH]C
Synonyms:- Boron, (methanol)trimethoxy-, (T-4)-
- Methanol, boron complex
- Boric acid (H3BO3), trimethyl ester, compd. with methanol
- Methanol, compd. with boric acid (H3BO3) trimethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
