
CAS 7144-22-1
:1,2,4-Triazolo[4,3-a][1,3,5]triazine-3,5,7-triamine
Description:
1,2,4-Triazolo[4,3-a][1,3,5]triazine-3,5,7-triamine, with the CAS number 7144-22-1, is a heterocyclic compound characterized by its complex triazole and triazine ring structure. This compound features three amino groups (-NH2) attached to the triazine moiety, which contributes to its potential as a versatile building block in organic synthesis and materials science. It exhibits properties typical of nitrogen-rich compounds, such as high thermal stability and potential for forming hydrogen bonds, which can influence its solubility and reactivity. The presence of multiple nitrogen atoms also suggests potential applications in pharmaceuticals, agrochemicals, and as a precursor for energetic materials. Additionally, its unique structure may impart interesting electronic properties, making it a candidate for research in fields such as coordination chemistry and molecular electronics. Overall, 1,2,4-Triazolo[4,3-a][1,3,5]triazine-3,5,7-triamine is a compound of interest due to its diverse chemical properties and potential applications.
Formula:C4H6N8
InChI:InChI=1S/C4H6N8/c5-1-8-2(6)12-3(7)10-11-4(12)9-1/h(H2,7,10)(H4,5,6,8,9,11)
InChI key:InChIKey=KMZCSSCUBKHIJS-UHFFFAOYSA-N
SMILES:NC=1N2C(N=C(N)N1)=NN=C2N
Synonyms:- 1,2,4-Triazolo[4,3-a][1,3,5]triazine-3,5,7-triamine
- NSC 8156
- s-Triazolo[4,3-a]-s-triazine, 3,5,7-triamino-
- NSC 73583
- 3,5,7-Triamino-s-triazolo[4,3-a]-s-triazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.