CAS 71448-11-8

N-(phenylcarbonyl)-L-alanyl-N~5~-(diaminomethylidene)-L-ornithine

Description:

N-(phenylcarbonyl)-L-alanyl-N~5~-(diaminomethylidene)-L-ornithine, with the CAS number 71448-11-8, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a complex structure that includes an L-alanine moiety and an ornithine backbone, which is modified by the presence of a phenylcarbonyl group and a diaminomethylidene group. The presence of these functional groups suggests that the compound may exhibit unique biochemical properties, potentially influencing its solubility, reactivity, and interaction with biological systems. Typically, such compounds are of interest in medicinal chemistry and biochemistry due to their potential roles in metabolic pathways or as precursors to bioactive molecules. The specific stereochemistry of the amino acids involved can also play a crucial role in determining the compound's biological activity. However, detailed studies would be necessary to elucidate its precise characteristics, including its stability, reactivity, and potential applications in pharmaceuticals or research.

Formula: C₁₆H₂₃N₅O₄

InChI: InChI=1/C16H23N5O4/c1-10(20-14(23)11-6-3-2-4-7-11)13(22)21-12(15(24)25)8-5-9-19-16(17)18/h2-4,6-7,10,12H,5,8-9H2,1H3,(H,20,23)(H,21,22)(H,24,25)(H4,17,18,19)/t10-,12-/m0/s1

SMILES: C[C@@H](C(=N[C@@H](CCCNC(=N)N)C(=O)O)O)N=C(c1ccccc1)O

Synonyms:

• Bz-Ala-Arg-Oh

Bz-Ala-Arg-OH

CAS: 71448-11-8

A good substrate for carboxypeptidases B and N.

Formula: C₁₆H₂₃N₅O₄

Purity: > 99%

Color and Shape: White Powder

Molecular weight: 349.39

Ref: 01-4017070

Bz-Ala-Arg

CAS: 71448-11-8

Bz-Ala-Arg, a dipeptide, serves as a spectrophotometric substrate (0.4 M pyridine formate, pH 4.25) for human pancreatic carboxypeptidase B and plasma

Formula: C₁₆H₂₃N₅O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 349.38

Ref: TM-T80113

Bz-Ala-Arg-OH

CAS: 71448-11-8

Bz-Ala-Arg-OH (BAR) is a peptidase that hydrolyzes peptide bonds in proteins. BAR has been shown to have an intravascular function, which means it is found in the blood and vascular endothelium. BAR has also been shown to be an effective agent for inhibiting the release of hydrogen peroxide (H2O2) induced by dimethylthiourea in isolated rat lungs. BAR was isolated from the rat hypothalamus and shows a high degree of similarity to other peptidases such as aminopeptidase N, carboxypeptidase A, and carboxypeptidase B. These enzymes are involved in the catabolism of hormones such as angiotensin II, adrenocorticotropic hormone, and vasopressin.

Formula: C₁₆H₂₃N₅O₄

Purity: Min. 95%

Molecular weight: 349.39 g/mol

Ref: 3D-FB108281