CAS 7145-28-0

2-methoxypyridine-3-carboxamide

Description:

2-Methoxypyridine-3-carboxamide, with the CAS number 7145-28-0, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methoxy group (-OCH3) attached to the second carbon of the pyridine ring and a carboxamide group (-C(=O)NH2) at the third position. The presence of these functional groups imparts specific chemical properties, such as the ability to engage in hydrogen bonding due to the amide group, which can influence its solubility and reactivity. 2-Methoxypyridine-3-carboxamide is typically a solid at room temperature and may exhibit moderate polarity, making it soluble in polar solvents. It is often utilized in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, its structural features may contribute to biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₇H₈N₂O₂

InChI: InChI=1/C7H8N2O2/c1-11-7-5(6(8)10)3-2-4-9-7/h2-4H,1H3,(H2,8,10)

SMILES: COc1c(cccn1)C(=O)N

2-Methoxypyridine-3-carboxamide

CAS: 7145-28-0

2-Methoxypyridine-3-carboxamide (2MP) is a novel antitumor agent that inhibits cell growth and induces rapid apoptosis in different types of cancer cells. 2MP inhibits tumor growth by inhibiting the synthesis of nicotinamide adenine dinucleotide (NAD), which is important for energy production in cells. 2MP also inhibits the activity of the enzyme, DNA topoisomerase II, which is involved in DNA replication and repair. This drug has been shown to be effective against lung cancer, colon cancer, breast cancer and MCF-7 human breast carcinoma cells.

Formula: C₇H₈N₂O₂

Purity: Min. 95%

Molecular weight: 152.15 g/mol

Ref: 3D-HAA14528