CAS 7145-71-3

5-Acetamidoindole

Description:

5-Acetamidoindole is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features an acetamido group (-NHCOCH3) at the 5-position of the indole ring, which influences its chemical reactivity and solubility. It is typically a white to off-white solid and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO), but may have limited solubility in water. 5-Acetamidoindole is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as anti-inflammatory and anticancer properties. The presence of the acetamido group can enhance its pharmacological profile by improving its metabolic stability and bioavailability. Additionally, this compound can serve as a building block in the synthesis of more complex molecules, making it valuable in drug development and research. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1/C10H10N2O/c1-7(13)12-9-2-3-10-8(6-9)4-5-11-10/h2-6,11H,1H3,(H,12,13)

SMILES: CC(=Nc1ccc2c(cc[nH]2)c1)O

Synonyms:

• N-(1H-indol-5-yl)acetamide
• Nsc74979
• 5-ACETAMIDOINDOLE
• Acetamide, N-1H-indol-5-yl-

N-(1H-Indol-5-yl)acetamide

CAS: 7145-71-3

Formula: C₁₀H₁₀N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 174.1992

Ref: IN-DA005UDK

N-(1H-Indol-5-yl)acetamide

CAS: 7145-71-3

N-(1H-Indol-5-yl)acetamide

Purity: 97%

Molecular weight: 174.20g/mol

Ref: 54-OR931441

N-(1H-Indol-5-yl)acetamide

CAS: 7145-71-3

Formula: C₁₀H₁₀N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 174.203

Ref: 10-F226215

N-(1H-Indol-5-yl)acetamide

CAS: 7145-71-3

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₂O

Purity: Min. 95%

Molecular weight: 174.2 g/mol

Ref: 3D-HAA14571