CAS 71458-12-3

trans-1-(bromomethyl)-4-propylcyclohexane

Description:

Trans-1-(bromomethyl)-4-propylcyclohexane is an organic compound characterized by its cyclohexane ring structure, which features a bromomethyl group and a propyl group attached to different carbon atoms. The "trans" designation indicates that the bromomethyl and propyl substituents are positioned on opposite sides of the cyclohexane ring, which influences the compound's three-dimensional conformation and physical properties. This compound is typically a colorless to pale yellow liquid at room temperature and may exhibit a characteristic odor. Its molecular structure contributes to its reactivity, particularly in nucleophilic substitution reactions due to the presence of the bromine atom, which can be displaced by various nucleophiles. Additionally, the presence of the propyl group can affect the compound's solubility and boiling point, making it more hydrophobic compared to simpler cyclohexane derivatives. As with many brominated compounds, it is important to handle trans-1-(bromomethyl)-4-propylcyclohexane with care due to potential toxicity and environmental concerns associated with brominated organic compounds.

Formula: C₁₀H₁₉Br

InChI: InChI=1/C10H19Br/c1-2-3-9-4-6-10(8-11)7-5-9/h9-10H,2-8H2,1H3/t9-,10-

SMILES: CCC[C@H]1CC[C@@H](CC1)CBr