CAS 71458-51-0
:N'-(tricyclo[3.3.1.1~3,7~]dec-1-ylcarbonyl)pyridine-4-carbohydrazide
Description:
N'-(tricyclo[3.3.1.1^3,7]dec-1-ylcarbonyl)pyridine-4-carbohydrazide is a chemical compound characterized by its complex structure, which includes a tricyclic decalin framework and a pyridine ring. The presence of the carbonyl group linked to the tricyclic system contributes to its reactivity, particularly in forming hydrazones and other derivatives. This compound features a hydrazide functional group, which is known for its potential biological activity, including antimicrobial and anticancer properties. The molecular structure suggests that it may exhibit interesting physicochemical properties, such as solubility in organic solvents and potential for hydrogen bonding due to the presence of the hydrazide moiety. Its unique arrangement of atoms may also influence its stereochemistry and interactions with biological targets. Overall, this compound represents a class of organic molecules that could be of interest in medicinal chemistry and material science, although specific applications would depend on further research and characterization.
Formula:C17H21N3O2
InChI:InChI=1/C17H21N3O2/c21-15(14-1-3-18-4-2-14)19-20-16(22)17-8-11-5-12(9-17)7-13(6-11)10-17/h1-4,11-13H,5-10H2,(H,19,21)(H,20,22)
Synonyms:- N'-(Adamantan-1-ylcarbonyl)isonicotinohydrazide
- 4-Pyridinecarboxylic acid, 2-(tricyclo[3.3.1.1~3,7~]dec-1-ylcarbonyl)hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Supradamal
CAS:<p>Supradamal is a potent Inhibitor of Plasmodium FK506 Binding Protein 35 (FKBD35). It also acts as an HIV inhibitor.</p>Formula:C17H21N3O2Color and Shape:SolidMolecular weight:299.37
