CAS 7146-37-4
:2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid hydrate
Description:
2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid hydrate, with the CAS number 7146-37-4, is an organic compound characterized by its amino acid structure, which includes an amino group (-NH2), a carboxylic acid group (-COOH), and a pyrrolo[2,3-b]pyridine moiety. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrophilic carboxylic acid and amino groups. The pyrrolo[2,3-b]pyridine ring contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The hydrate form indicates that the compound can associate with water molecules, which may influence its stability and solubility. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. As with many amino acids, it may participate in various biochemical processes, including protein synthesis and enzyme activity modulation.
Formula:C10H13N3O3
InChI:InChI=1/C10H11N3O2.H2O/c11-8(10(14)15)4-6-5-13-9-7(6)2-1-3-12-9;/h1-3,5,8H,4,11H2,(H,12,13)(H,14,15);1H2
SMILES:c1cc2c(CC(C(=O)O)N)c[nH]c2nc1.O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dl-7-azatryptophan monohydrate
CAS:Formula:C10H13N3O3Purity:95%Color and Shape:SolidMolecular weight:223.2285DL-7-Azatryptophan hydrate
CAS:DL-7-Azatryptophan hydrate
Purity:95%Color and Shape:White PowderMolecular weight:223.23g/molD,L-Azatryptophan hydrate
CAS:Azatryptophan hydrate is an organic compound that is a useful building block, reagent, and intermediate in the synthesis of many complex compounds. Azatryptophan hydrate is soluble in water and reacts readily with a variety of other compounds. It can be used as a starting material to prepare complex molecules such as heterocycles and natural products. Azatryptophan hydrate has been shown to have high purity and quality and is often used as a research chemical or speciality chemical for commercial purposes.
Formula:C10H13N3O3Purity:Min. 95%Color and Shape:White To Light (Or Pale) Yellow SolidMolecular weight:223.23 g/molD,L-Azatryptophan Hydrate
CAS:Controlled ProductFormula:C10H13N3O3Color and Shape:NeatMolecular weight:223.23DL-7-Azatryptophan monohydrate
CAS:DL-7-Azatryptophan monohydrate is a fine chemical that has been used as a versatile building block in organic synthesis and as a research chemical.
Formula:C10H13N3O3Purity:Min. 99.0 Area-%Molecular weight:223.23 g/mol



