CAS 7146-63-6
:methyl 2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-phenylpropanoate
Description:
Methyl 2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-phenylpropanoate, identified by its CAS number 7146-63-6, is a chemical compound that features a complex structure characterized by the presence of an isoindole moiety and a phenylpropanoate group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. It may display moderate to high solubility in organic solvents, while its solubility in water is generally limited due to the hydrophobic nature of the phenyl group. The presence of the dioxo functional groups suggests potential for hydrogen bonding and reactivity in various chemical transformations. Methyl esters, like this compound, are often used in organic synthesis and may serve as intermediates in the production of pharmaceuticals or agrochemicals. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C18H15NO4
InChI:InChI=1/C18H15NO4/c1-23-18(22)15(11-12-7-3-2-4-8-12)19-16(20)13-9-5-6-10-14(13)17(19)21/h2-10,15H,11H2,1H3
SMILES:COC(=O)C(Cc1ccccc1)N1C(=O)c2ccccc2C1=O
Synonyms:- 2H-isoindole-2-acetic acid, 1,3-dihydro-1,3-dioxo-alpha-(phenylmethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.