CAS 7146-78-3

2-(2-ethylbutyl)cyclohexanol

Description:

2-(2-Ethylbutyl)cyclohexanol is an organic compound characterized by its cyclohexanol structure, which features a cyclohexane ring with a hydroxyl (-OH) group and a 2-ethylbutyl substituent. This compound is typically a colorless to pale yellow liquid at room temperature, exhibiting a moderate viscosity. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic hydrocarbon chain. The presence of the hydroxyl group imparts some polar characteristics, allowing for hydrogen bonding, which can influence its reactivity and interactions with other substances. 2-(2-Ethylbutyl)cyclohexanol may be used in various applications, including as a solvent, plasticizer, or intermediate in chemical synthesis. Its physical and chemical properties, such as boiling point, melting point, and density, can vary based on the specific conditions and purity of the substance. Safety data should be consulted to understand its handling and potential hazards, as with any chemical compound.

Formula: C₁₂H₂₄O

InChI: InChI=1/C12H24O/c1-3-10(4-2)9-11-7-5-6-8-12(11)13/h10-13H,3-9H2,1-2H3

SMILES: CCC(CC)CC1CCCCC1O

Synonyms:

• 1-Cyclohexanol, 2-(2-ethylbutyl)-
• Cyclohexanol, 2-(2-Ethylbutyl)-