
CAS 7146-82-9
:Ethyl 3-oxoeicosanoate
Description:
Ethyl 3-oxoeicosanoate, with the CAS number 7146-82-9, is an ester derived from eicosanoic acid and ethanol. This compound features a long hydrocarbon chain, which contributes to its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. Ethyl 3-oxoeicosanoate is characterized by the presence of a ketone functional group (the 3-oxo group) within its structure, which can influence its reactivity and interactions with other molecules. This compound is typically used in various applications, including as a flavoring agent, fragrance component, or in the synthesis of other chemical compounds. Its properties may include a relatively high boiling point due to the long carbon chain, and it may exhibit moderate volatility. Additionally, the presence of the ketone group can impart specific chemical reactivity, making it useful in organic synthesis. Overall, ethyl 3-oxoeicosanoate is a versatile compound with applications in both industrial and research settings.
Formula:C22H42O3
InChI:InChI=1S/C22H42O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)20-22(24)25-4-2/h3-20H2,1-2H3
InChI key:InChIKey=ZSZUZHXUJXYSMM-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCC)C(CC(OCC)=O)=O
Synonyms:- Ethyl 3-oxoeicosanoate
- Ethyl stearoylacetate
- Eicosanoic acid, 3-oxo-, ethyl ester
- NSC 60669
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.