CAS 7146-86-3

1-(2-hydroxyphenyl)-3-(3-methoxyphenyl)prop-2-en-1-one

Description:

1-(2-hydroxyphenyl)-3-(3-methoxyphenyl)prop-2-en-1-one, also known as chalcone, is an organic compound characterized by its structure, which features a chalcone backbone with specific substituents. This compound typically exhibits a yellow to orange color and is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. The presence of the hydroxyl group and methoxy group on the phenyl rings enhances its reactivity and solubility in organic solvents. It is often studied in the context of organic synthesis and medicinal chemistry due to its ability to serve as a precursor for various derivatives. Additionally, chalcones can undergo various chemical reactions, such as cyclization and reduction, making them versatile intermediates in the synthesis of more complex molecules. The compound's properties, such as melting point, solubility, and spectral characteristics, can vary based on the specific conditions and purity of the sample. Overall, 1-(2-hydroxyphenyl)-3-(3-methoxyphenyl)prop-2-en-1-one is a significant compound in both research and potential therapeutic applications.

Formula: C₁₆H₁₄O₃

InChI: InChI=1/C16H14O3/c1-19-13-6-4-5-12(11-13)9-10-16(18)14-7-2-3-8-15(14)17/h2-11,17H,1H3

Synonyms:

• 2'-Hydroxy-3-methoxychalcone
• 2-Propen-1-one, 1-(2-hydroxyphenyl)-3-(3-methoxyphenyl)-, (2E)-
• 7146-86-3
• (2E)-1-(2-hydroxyphenyl)-3-(3-methoxyphenyl)prop-2-en-1-one

2-Hydroxy-3-methoxy chalcone

CAS: 7146-86-3

2-Hydroxy-3-methoxy chalcone has anticancer activity and inhibits colon cancer.

Formula: C₁₆H₁₄O₃

Purity: 98.06%

Color and Shape: Soild

Molecular weight: 254.28

Ref: TM-TN7226

2-Hydroxy-3-methoxy chalcone

CAS: 7146-86-3

2-Hydroxy-3-methoxy chalcone

Purity: ≥98%

Molecular weight: 254.28g/mol

Ref: 54-BUP09129

2'-Hydroxy-3-methoxychalcone

CAS: 7146-86-3

2'-Hydroxy-3-methoxychalcone is a type of chalcone flavonoid, which is a naturally occurring compound commonly isolated from various plant species. This compound serves as an intermediate in the biosynthesis of flavonoids and is characterized by its distinctive chemical structure featuring both hydroxyl and methoxy functional groups. The mode of action of 2'-Hydroxy-3-methoxychalcone involves its ability to modulate multiple signaling pathways. It exhibits significant antioxidant properties, scavenging reactive oxygen species and thereby reducing oxidative stress. Moreover, it has been shown to possess anti-inflammatory effects by inhibiting the production of pro-inflammatory cytokines. Additionally, it demonstrates anticancer activities through the induction of apoptosis and inhibition of cell proliferation.

Formula: C₁₆H₁₄O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 254.28 g/mol

Ref: 3D-FH66393