CAS 71463-16-6
:2-(2-nitrophenyl)acrylaldehyde
Description:
2-(2-Nitrophenyl)acrylaldehyde, identified by the CAS number 71463-16-6, is an organic compound characterized by its structure, which features a nitrophenyl group attached to an acrylaldehyde moiety. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can influence its electronic properties and reactivity. It is likely to be a solid at room temperature and may have a distinct aromatic odor. The presence of both the aldehyde functional group and the nitro substituent suggests that it may participate in various chemical reactions, including nucleophilic additions and electrophilic substitutions. Additionally, the compound may exhibit interesting photochemical properties, making it potentially useful in applications such as organic synthesis, materials science, or as a dye. Safety considerations should be taken into account, as nitro compounds can be hazardous, and appropriate handling and storage procedures should be followed.
Formula:C9H7NO3
InChI:InChI=1/C9H7NO3/c1-7(6-11)8-4-2-3-5-9(8)10(12)13/h2-6H,1H2
SMILES:C=C(C=O)c1ccccc1N(=O)=O
Synonyms:- 2-(2-Nitrophenyl)Prop-2-Enal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
