CAS 71463-40-6
:N-(5-Hydroxy-2-methylphenyl)acetamide
Description:
N-(5-Hydroxy-2-methylphenyl)acetamide, also known by its CAS number 71463-40-6, is an organic compound characterized by its amide functional group, which is derived from acetic acid and a substituted phenol. This compound features a hydroxyl group (-OH) and a methyl group (-CH3) on the aromatic ring, contributing to its unique chemical properties. It is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of the hydroxyl group. The compound may exhibit biological activity, potentially serving as a pharmaceutical intermediate or a research chemical. Its structure suggests that it could participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the presence of the hydroxyl group may impart some degree of acidity, while the acetamide moiety can enhance its stability and solubility in various environments. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c1-6-3-4-8(12)5-9(6)10-7(2)11/h3-5,12H,1-2H3,(H,10,11)
InChI key:InChIKey=MHQYNOHBRKPLGX-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(C)C=CC(O)=C1
Synonyms:- N-(5-Hydroxy-2-methylphenyl)acetamide
- o-Acetotoluidide, 5′-hydroxy-
- Acetamide, N-(5-hydroxy-2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
