CymitQuimica logo

CAS 7147-66-2

:

2,2'-propane-1,3-diylbis(1H-benzimidazole)

Description:
2,2'-Propane-1,3-diylbis(1H-benzimidazole), with the CAS number 7147-66-2, is an organic compound characterized by its unique structure, which features two benzimidazole moieties linked by a propane-1,3-diyl group. This compound typically exhibits properties associated with benzimidazole derivatives, such as potential biological activity, including antimicrobial and antifungal effects. The presence of the benzimidazole rings contributes to its aromatic character, which can influence its solubility and reactivity. Additionally, the compound may display interesting coordination chemistry due to the nitrogen atoms in the benzimidazole rings, making it a candidate for various applications in medicinal chemistry and materials science. Its synthesis often involves multi-step organic reactions, and it may be studied for its potential use in pharmaceuticals or as a ligand in coordination complexes. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature.
Formula:C17H16N4
InChI:InChI=1/C17H16N4/c1-2-7-13-12(6-1)18-16(19-13)10-5-11-17-20-14-8-3-4-9-15(14)21-17/h1-4,6-9H,5,10-11H2,(H,18,19)(H,20,21)
Synonyms:
  • 2,2'-Propane-1,3-diylbis(1H-benzimidazole)
  • 1H-Benzimidazole, 2,2'-(1,3-propanediyl)bis-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.