CymitQuimica logo

CAS 71479-93-1

:

1-(2-chloroethyl)-3-(2-hydroxyethyl)urea

Description:
1-(2-chloroethyl)-3-(2-hydroxyethyl)urea, with the CAS number 71479-93-1, is a chemical compound that belongs to the class of ureas. It is characterized by the presence of both a chloroethyl and a hydroxyethyl group, which contribute to its reactivity and potential applications. The chloroethyl group can participate in nucleophilic substitution reactions, making the compound useful in organic synthesis and medicinal chemistry. The hydroxyethyl group provides hydrophilicity, which may enhance solubility in polar solvents and influence biological interactions. This compound may exhibit biological activity, potentially serving as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its structure suggests that it could interact with biological macromolecules, which may lead to various pharmacological effects. Safety and handling precautions should be observed, as compounds containing halogens and functional groups like urea can pose health risks. Overall, 1-(2-chloroethyl)-3-(2-hydroxyethyl)urea is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C5H11ClN2O2
InChI:InChI=1/C5H11ClN2O2/c6-1-2-7-5(10)8-3-4-9/h9H,1-4H2,(H2,7,8,10)
SMILES:C(CN=C(NCCO)O)Cl
Synonyms:
  • Urea, N-(2-chloroethyl)-N'-(2-hydroxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.