CAS 71486-49-2
:2-Naphthalenesulfonic acid, 6-amino-4-hydroxy-, mono(4-carboxyphenyl) deriv.
Description:
2-Naphthalenesulfonic acid, 6-amino-4-hydroxy-, mono(4-carboxyphenyl) deriv. is an organic compound characterized by its complex structure, which includes a naphthalene ring substituted with a sulfonic acid group, an amino group, and a hydroxy group, along with a carboxyphenyl moiety. This compound typically exhibits properties such as high solubility in polar solvents due to the presence of functional groups that can engage in hydrogen bonding and ionic interactions. It is likely to be a solid at room temperature, with potential applications in dye chemistry, as a pH indicator, or as an intermediate in organic synthesis. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including electrophilic substitution and coupling reactions. Additionally, its sulfonic acid group contributes to its acidity, making it a potential candidate for use in acid-base chemistry. Overall, this compound's unique structure and functional groups make it a versatile substance in both industrial and research applications.
Formula:C17H13NO6S
InChI:InChI=1/C17H13NO6S/c19-16-9-14(25(22,23)24)7-11-3-6-13(8-15(11)16)18-12-4-1-10(2-5-12)17(20)21/h1-9,18-19H,(H,20,21)(H,22,23,24)
SMILES:c1cc(ccc1C(=O)O)Nc1ccc2cc(cc(c2c1)O)S(=O)(=O)O
Synonyms:- 2-Naphthalenesulfonic acid, 6-amino-4-hydroxy-, mono(4-carboxyphenyl) deriv.
- 4-[(8-Hydroxy-6-Sulfonaphthalen-2-Yl)Amino]Benzoic Acid
- N-4-Carboxy Phenyl-γ-Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.