CymitQuimica logo

CAS 71487-08-6

:

4,4′-[Oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] di-4-morpholinepropanoate

Description:
4,4′-[Oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] di-4-morpholinepropanoate, with CAS number 71487-08-6, is a chemical compound characterized by its complex structure, which includes morpholine and ether linkages. This substance typically exhibits properties associated with polyfunctional compounds, including potential solubility in polar solvents due to the presence of ether groups. It may also demonstrate moderate thermal stability and could be sensitive to hydrolysis under certain conditions. The morpholine moiety suggests that the compound may possess basic characteristics, potentially allowing it to engage in various chemical reactions, such as nucleophilic substitutions. Additionally, due to its structural features, it may find applications in fields such as polymer chemistry, surfactants, or as an intermediate in organic synthesis. Safety data should be consulted for handling and usage, as compounds with morpholine derivatives can pose health risks if not managed properly. Overall, this compound's unique structure and functional groups contribute to its reactivity and potential applications in various chemical processes.
Formula:C22H40N2O9
InChI:InChI=1S/C22H40N2O9/c25-21(1-3-23-5-9-27-10-6-23)32-19-17-30-15-13-29-14-16-31-18-20-33-22(26)2-4-24-7-11-28-12-8-24/h1-20H2
InChI key:InChIKey=VPUMVHRPBGQYNP-UHFFFAOYSA-N
SMILES:C(CC(OCCOCCOCCOCCOC(CCN1CCOCC1)=O)=O)N2CCOCC2
Synonyms:
  • 4-Morpholinepropanoic acid, 4,4′-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] ester
  • 4-Morpholinepropanoic acid, oxybis(2,1-ethanediyloxy-2,1-ethanediyl) ester
  • 4,4′-[Oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] di-4-morpholinepropanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.