CAS 7149-51-1
:2-(cyclohexylideneamino)cyclohex-1-ene-1-carboxamide
Description:
2-(Cyclohexylideneamino)cyclohex-1-ene-1-carboxamide, with the CAS number 7149-51-1, is an organic compound characterized by its unique structural features. It contains a cyclohexene ring, which contributes to its cyclic and unsaturated nature, and an amide functional group that imparts specific reactivity and solubility properties. The presence of the cyclohexylideneamino group indicates that it has a nitrogen atom bonded to a cyclohexylidene moiety, which can influence its steric and electronic properties. This compound may exhibit moderate polarity due to the amide group, affecting its solubility in various solvents. Additionally, the structural configuration suggests potential for intramolecular interactions, which could impact its stability and reactivity. Such compounds may be of interest in synthetic organic chemistry and could have applications in pharmaceuticals or materials science, depending on their specific reactivity and properties. Further studies would be necessary to fully elucidate its behavior in different chemical environments.
Formula:C13H20N2O
InChI:InChI=1/C13H20N2O/c14-13(16)11-8-4-5-9-12(11)15-10-6-2-1-3-7-10/h1-9H2,(H2,14,16)
SMILES:C1CCC(=NC2=C(CCCC2)C(=N)O)CC1
Synonyms:- 1-Cyclohexene-1-carboxamide, 2-(cyclohexylideneamino)-
- 2-(Cyclohexylideneamino)cyclohex-1-ene-1-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.