CAS 7149-69-1

1,3-dichloro-2-methyl-5-nitrobenzene

Description:

1,3-Dichloro-2-methyl-5-nitrobenzene is an aromatic compound characterized by the presence of two chlorine atoms, a methyl group, and a nitro group attached to a benzene ring. Its molecular structure features a dichlorobenzene framework, where the chlorine substituents are located at the 1 and 3 positions, while the methyl and nitro groups are positioned at the 2 and 5 positions, respectively. This compound is typically a yellow to brown solid at room temperature and is known for its moderate solubility in organic solvents. It exhibits properties typical of nitro-substituted aromatic compounds, including potential reactivity in electrophilic substitution reactions. The presence of the nitro group contributes to its electron-withdrawing characteristics, influencing its reactivity and stability. Additionally, 1,3-dichloro-2-methyl-5-nitrobenzene may pose environmental and health risks, necessitating careful handling and disposal in accordance with safety regulations. Its applications may include use in organic synthesis and as an intermediate in the production of other chemical compounds.

Formula: C₇H₅Cl₂NO₂

InChI: InChI=1/C7H5Cl2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3

SMILES: Cc1c(cc(cc1Cl)N(=O)=O)Cl

Synonyms:

• 2,6-Dichloro-4-nitrotoluene

1,3-Dichloro-2-methyl-5-nitrobenzene

CAS: 7149-69-1

Formula: C₇H₅Cl₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 206.0261

Ref: IN-DA00FAHY

2,6-Dichloro-4-nitrotoluene

CAS: 7149-69-1

2,6-Dichloro-4-nitrotoluene

Purity: 97%

Color and Shape: Pale Yellow Solid

Molecular weight: 206.03g/mol

Ref: 54-OR25607

1,3-Dichloro-2-methyl-5-nitro-benzene

CAS: 7149-69-1

Formula: C₇H₅Cl₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 206.02

Ref: 10-F049482