CAS 7149-76-0

1,4-Dichloro-2-methyl-5-nitrobenzene

Description:

1,4-Dichloro-2-methyl-5-nitrobenzene, with the CAS number 7149-76-0, is an aromatic compound characterized by the presence of two chlorine atoms, a methyl group, and a nitro group attached to a benzene ring. This compound typically appears as a yellow to brown solid and is known for its relatively low solubility in water, while being more soluble in organic solvents. It exhibits a melting point that is influenced by its molecular structure and substituents. The presence of the nitro group contributes to its potential reactivity, making it a candidate for various chemical reactions, including electrophilic substitution. Additionally, the chlorinated and nitro substituents can impart specific properties such as increased stability and potential toxicity, which necessitates careful handling and consideration of environmental impact. 1,4-Dichloro-2-methyl-5-nitrobenzene is often used in research and industrial applications, particularly in the synthesis of other chemical compounds and as an intermediate in organic synthesis.

Formula: C₇H₅Cl₂NO₂

InChI: InChI=1S/C7H5Cl2NO2/c1-4-2-6(9)7(10(11)12)3-5(4)8/h2-3H,1H3

InChI key: InChIKey=PEQYJEJKUTUIFJ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(Cl)C=C(C)C(Cl)=C1

Synonyms:

• NSC 72330
• Benzene, 1,4-dichloro-2-methyl-5-nitro-
• 1,4-Dichloro-2-methyl-5-nitrobenzene
• Toluene, 2,5-dichloro-4-nitro-
• 2,5-Dichloro-4-methylnitrobenzene

1,4-Dichloro-2-methyl-5-nitrobenzene

CAS: 7149-76-0

1,4-Dichloro-2-methyl-5-nitrobenzene

Purity: 98%

Molecular weight: 206.03g/mol

Ref: 54-OR1036155

1,4-Dichloro-2-methyl-5-nitrobenzene

CAS: 7149-76-0

Purity: 98%

Molecular weight: 206.0200043

Ref: 10-F660946

1,4-Dichloro-2-methyl-5-nitrobenzene

CAS: 7149-76-0

1,4-Dichloro-2-methyl-5-nitrobenzene is an antipsychotic drug that belongs to the class of phenylpiperazine derivatives. It is a potent serotonin receptor antagonist with actions at dopamine D2 and D3 receptors. This drug has shown to have high affinity for the 5HT2A receptor and moderate affinity for the 5HT1A receptor. 1,4-Dichloro-2-methyl-5-nitrobenzene also has moderate affinity for the alpha1 adrenergic receptor and low affinity for the histamine H1 receptor. Ziprasidone prevents activation of these receptors by binding to them and blocking their ability to activate downstream effects on other cells. 1,4-Dichloro-2-methyl-5-nitrobenzene has been shown to be effective in treating schizophrenia, bipolar disorder, major depressive disorder and other psychotic disorders.

Formula: C₇H₅Cl₂NO₂

Purity: Min. 95%

Molecular weight: 206.02 g/mol

Ref: 3D-HAA14976