CAS 7149-78-2

N-(5-chloro-4-methyl-2-nitrophenyl)acetamide

Description:

N-(5-chloro-4-methyl-2-nitrophenyl)acetamide, with the CAS number 7149-78-2, is an organic compound characterized by its aromatic structure and functional groups. It features a chloro substituent, a methyl group, and a nitro group on a phenyl ring, which contribute to its chemical reactivity and properties. The presence of the acetamide group indicates that it can participate in various chemical reactions, such as nucleophilic substitutions and acylation reactions. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its nitro group can influence its electronic properties, making it a potential candidate for applications in pharmaceuticals or agrochemicals. Additionally, the chlorine atom can enhance the compound's lipophilicity, affecting its biological activity and interaction with other molecules. Safety and handling precautions should be observed due to the potential toxicity associated with nitro and chloro compounds.

Formula: C₉H₉ClN₂O₃

InChI: InChI=1/C9H9ClN2O3/c1-5-3-9(12(14)15)8(4-7(5)10)11-6(2)13/h3-4H,1-2H3,(H,11,13)

SMILES: Cc1cc(c(cc1Cl)N=C(C)O)N(=O)=O

4-Acetamido-2-chloro-5-nitrotoluene

CAS: 7149-78-2

Formula: C₉H₉ClN₂O₃

Color and Shape: Solid

Molecular weight: 228.6324

Ref: IN-DA00FD6G

4-Acetamido-2-chloro-5-nitrotoluene

CAS: 7149-78-2

Versatile small molecule scaffold

Formula: C₉H₉ClN₂O₃

Purity: Min. 95%

Molecular weight: 228.63 g/mol

Ref: 3D-HAA14978