CymitQuimica logo

CAS 7149-92-0

:

2,4-dimethoxy-3-methylbenzaldehyde

Description:
2,4-Dimethoxy-3-methylbenzaldehyde, with the CAS number 7149-92-0, is an organic compound belonging to the class of aromatic aldehydes. It features a benzene ring substituted with two methoxy groups (-OCH3) at the 2 and 4 positions and a methyl group (-CH3) at the 3 position, along with an aldehyde functional group (-CHO) at the 1 position. This compound is typically a colorless to pale yellow liquid with a pleasant aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. The presence of the aldehyde group makes it reactive, particularly in condensation reactions and as a potential electrophile in various organic synthesis processes. Additionally, the methoxy groups can influence the compound's reactivity and stability, often enhancing its electron-donating properties. 2,4-Dimethoxy-3-methylbenzaldehyde is utilized in the synthesis of various organic compounds and may have applications in fragrance and flavor industries.
Formula:C10H12O3
InChI:InChI=1/C10H12O3/c1-7-9(12-2)5-4-8(6-11)10(7)13-3/h4-6H,1-3H3
InChI key:UOKAZUWUHOBBMD-UHFFFAOYSA-N
SMILES:Cc1c(ccc(C=O)c1OC)OC
Synonyms:
  • 2,4-Dimethoxy-3-Methyl-Benzaldehyde
Found 5 products.