CAS 71493-76-0

2-amino-4-methylpyridine-3-carbonitrile

Description:

2-Amino-4-methylpyridine-3-carbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an amino group (-NH2) at the 2-position and a cyano group (-C≡N) at the 3-position, along with a methyl group (-CH3) at the 4-position, contributes to its unique chemical properties. This compound typically exhibits polar characteristics due to the amino and cyano functional groups, which can engage in hydrogen bonding and dipole interactions. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The compound's reactivity can be influenced by the electron-withdrawing nature of the cyano group and the electron-donating properties of the amino group, making it a versatile building block in various chemical reactions. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions.

Formula: C₇H₇N₃

InChI: InChI=1/C7H7N3/c1-5-2-3-10-7(9)6(5)4-8/h2-3H,1H3,(H2,9,10)

SMILES: Cc1cc[nH]c(=N)c1C#N

Synonyms:

• 2-Amino-4-methylnicotinonitrile
• 3-Pyridinecarbonitrile, 2-Amino-4-Methyl-

2-Amino-4-methylnicotinonitrile

CAS: 71493-76-0

2-Amino-4-methylnicotinonitrile

Formula: C₇H₇N₃

Purity: ≥95%

Color and Shape: off-white to yellow solid

Molecular weight: 133.15g/mol

Ref: 54-OR17000

2-Amino-4-methyl-nicotinonitrile

CAS: 71493-76-0

Formula: C₇H₇N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 133.154

Ref: 10-F048188