CAS 714939-06-7
:5-(2-methoxy-5-nitrophenyl)furan-2-carbaldehyde
Description:
5-(2-Methoxy-5-nitrophenyl)furan-2-carbaldehyde is an organic compound characterized by its furan and aldehyde functional groups, along with a nitrophenyl substituent. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. The nitro group is known for its electron-withdrawing properties, which can affect the compound's electronic characteristics and reactivity, particularly in electrophilic aromatic substitution reactions. This compound may exhibit interesting optical properties due to the conjugation between the furan ring and the aromatic system, potentially making it useful in various applications, including organic synthesis and materials science. Additionally, the aldehyde functional group can participate in further chemical reactions, such as condensation or reduction, allowing for the synthesis of more complex molecules. Overall, the unique structural features of 5-(2-methoxy-5-nitrophenyl)furan-2-carbaldehyde contribute to its potential utility in research and industrial applications.
Formula:C12H9NO5
InChI:InChI=1/C12H9NO5/c1-17-11-4-2-8(13(15)16)6-10(11)12-5-3-9(7-14)18-12/h2-7H,1H3
SMILES:COc1ccc(cc1c1ccc(C=O)o1)N(=O)=O
Synonyms:- 2-Furancarboxaldehyde, 5-(2-Methoxy-5-Nitrophenyl)-
- 5-(2-Methoxy-5-nitrophenyl)-2-furaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
