CAS 714953-84-1

1-[amino(4-nitrophenyl)methyl]naphthalen-2-ol hydrochloride

Description:

1-[Amino(4-nitrophenyl)methyl]naphthalen-2-ol hydrochloride is a chemical compound characterized by its complex structure, which includes a naphthalene moiety substituted with an amino group and a nitrophenyl group. This compound typically appears as a crystalline solid and is soluble in polar solvents, reflecting its functional groups' ability to engage in hydrogen bonding. The presence of the amino group suggests potential basicity, while the nitro group may impart electron-withdrawing properties, influencing the compound's reactivity and stability. The hydrochloride form indicates that the compound is a salt, which can enhance its solubility in aqueous solutions. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs or as a biochemical probe. Its specific interactions and applications would depend on further studies, including its mechanism of action and potential therapeutic uses. As with any chemical substance, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₇H₁₅ClN₂O₃

InChI: InChI=1/C17H14N2O3.ClH/c18-17(12-5-8-13(9-6-12)19(21)22)16-14-4-2-1-3-11(14)7-10-15(16)20;/h1-10,17,20H,18H2;1H

SMILES: c1ccc2c(c1)ccc(c2C(c1ccc(cc1)N(=O)=O)N)O.Cl

1-[Amino-(4-nitro-phenyl)-methyl]-naphthalen-2-ol hydrochloride

CAS: 714953-84-1

1-[Amino-(4-nitro-phenyl)-methyl]-naphthalen-2-ol hydrochloride

Purity: ≥95%

Molecular weight: 330.77g/mol

Ref: 54-OR307609