CAS 714953-85-2

1-[amino(4-bromophenyl)methyl]naphthalen-2-ol

Description:

1-[Amino(4-bromophenyl)methyl]naphthalen-2-ol, with the CAS number 714953-85-2, is an organic compound characterized by its complex structure that includes a naphthalene moiety substituted with an amino group and a bromophenyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents due to its aromatic nature. The presence of the hydroxyl (-OH) group contributes to its potential as a phenolic compound, which may influence its reactivity and ability to form hydrogen bonds. The bromine atom in the para position of the phenyl ring can enhance the compound's electrophilicity, making it a candidate for various chemical reactions. Additionally, the amino group may impart basic characteristics, allowing for interactions with acids and other electrophiles. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features and potential biological activity.

Formula: C₁₇H₁₄BrNO

InChI: InChI=1/C17H14BrNO/c18-13-8-5-12(6-9-13)17(19)16-14-4-2-1-3-11(14)7-10-15(16)20/h1-10,17,20H,19H2

SMILES: c1ccc2c(c1)ccc(c2C(c1ccc(cc1)Br)N)O

Synonyms:

• 1-[Amino(4-bromophenyl)methyl]-2-naphthol
• 2-Naphthalenol, 1-[Amino(4-Bromophenyl)Methyl]-

1-[Amino-(4-bromo-phenyl)-methyl]-naphthalen-2-ol

CAS: 714953-85-2

1-[Amino-(4-bromo-phenyl)-methyl]-naphthalen-2-ol

Purity: ≥95%

Molecular weight: 328.20g/mol

Ref: 54-OR307610