CAS 714964-61-1
:(2S)-2-(tert-butoxycarbonylamino)-2,3,3,3-tetradeuterio-propanoic acid
Description:
The chemical substance known as (2S)-2-(tert-butoxycarbonylamino)-2,3,3,3-tetradeuterio-propanoic acid, with the CAS number 714964-61-1, is an amino acid derivative characterized by the presence of a tert-butoxycarbonyl (Boc) protecting group on the amino group. This compound features a deuterated propanoic acid backbone, where the presence of deuterium isotopes enhances its stability and can be useful in various analytical applications, such as NMR spectroscopy. The (2S) designation indicates that the molecule has a specific stereochemistry, which is crucial for its biological activity and interactions. The tert-butoxycarbonyl group serves as a protective group that can be removed under specific conditions, allowing for further functionalization or incorporation into peptides. This compound is typically used in organic synthesis and peptide chemistry, particularly in the synthesis of labeled peptides for research purposes. Its unique isotopic composition and protective group make it valuable in studies involving metabolic pathways and drug development.
Formula:C8H11D4NO4
InChI:InChI=1/C8H15NO4/c1-5(6(10)11)9-7(12)13-8(2,3)4/h5H,1-4H3,(H,9,12)(H,10,11)/t5-/m0/s1/i1D3,5D
SMILES:C([C@@](C(=O)O)(N=C(O)OC(C)(C)C)[2H])([2H])([2H])[2H]
Synonyms:- L-alanine-2,3,3,3-d4
- N-(tert-Butoxycarbonyl)-L-(2,3,3,3-2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-tert-Boc-L-alanine-D4
CAS:Formula:C8H15NO4Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:193.23L-Alanine-2,3,3,3-d4-N-t-BOC
CAS:Formula:CD3CD(NHtBOC)COOHPurity:98 atom % DColor and Shape:White SolidMolecular weight:193.24N-tert-Boc-L-alanine-D4
CAS:Controlled ProductApplications Used in peptide synthesis.
References Flohr, S., et al.: Chem. Eur. J., 5, 669 (1999), Kadereit, D., et al.: ChemBioChem., 1, 144 (2000), Volkert, M., et al.: Biol. Chem., 382, 1133 (2001),Formula:C82H4H11NO4Color and Shape:NeatMolecular weight:193.23N-tert-Boc-L-alanine-d4
CAS:Please enquire for more information about N-tert-Boc-L-alanine-d4 including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C8H15NO4Purity:Min. 95%Molecular weight:193.23 g/molRef: 3D-PDB96461
Discontinued product



