CAS 714971-28-5

tert-Butyl (3S)-3-(hydroxymethyl)morpholine-4-carboxylate

Description:

Tert-Butyl (3S)-3-(hydroxymethyl)morpholine-4-carboxylate is a chemical compound characterized by its morpholine structure, which includes a hydroxymethyl group and a tert-butyl ester functional group. This compound is typically used in organic synthesis and pharmaceutical applications due to its potential as a building block in the development of biologically active molecules. The presence of the morpholine ring contributes to its ability to interact with biological systems, while the tert-butyl group enhances its lipophilicity, potentially improving its solubility in organic solvents. The hydroxymethyl group can participate in various chemical reactions, making it a versatile intermediate. Additionally, the stereochemistry indicated by the (3S) designation suggests that the compound has specific spatial arrangements that may influence its biological activity and reactivity. Overall, this compound's unique structural features make it of interest in medicinal chemistry and related fields.

Formula: C₁₀H₁₉NO₄

InChI: InChI=1/C10H19NO4/c1-10(2,3)15-9(13)11-4-5-14-7-8(11)6-12/h8,12H,4-7H2,1-3H3/t8-/m0/s1

SMILES: CC(C)(C)OC(=O)N1CCOC[C@@H]1CO

Synonyms:

• (S)-3-Hydroxymethylmorpholine-4-carboxylic acid tert-butyl ester
• (S)-N-BOC-3-hydroxymethylmorpholine
• 3(S)-Hydroxymethyl-4-Bocmorpholine

(S)-3-Hydroxymethyl-4-Boc-morpholine

CAS: 714971-28-5

Formula: C₁₀H₁₉NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 217.2622

Ref: IN-DA003CNX

tert-Butyl (3S)-3-(hydroxymethyl)morpholine-4-carboxylate

CAS: 714971-28-5

tert-Butyl (3S)-3-(hydroxymethyl)morpholine-4-carboxylate

Purity: 97%

Molecular weight: 217.26g/mol

Ref: 54-OR308157

(S)-4-Boc-(3-hydroxymethyl)morpholine

CAS: 714971-28-5

Formula: C₁₀H₁₉NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 217.265

Ref: 10-F093774