CAS 714975-53-8

methyl 4-aminopyrimidine-5-carboxylate

Description:

Methyl 4-aminopyrimidine-5-carboxylate is an organic compound characterized by its pyrimidine ring structure, which includes an amino group and a carboxylate ester functional group. This compound typically appears as a crystalline solid and is soluble in polar solvents due to the presence of the carboxylate group. The amino group contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Methyl 4-aminopyrimidine-5-carboxylate is of interest in medicinal chemistry and pharmaceutical research, as derivatives of pyrimidine compounds often exhibit biological activity, including antimicrobial and anticancer properties. Its molecular structure allows for potential modifications that can enhance its pharmacological profile. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a versatile building block in organic synthesis and drug development.

Formula: C₆H₇N₃O₂

InChI: InChI=1/C6H7N3O2/c1-11-6(10)4-2-8-3-9-5(4)7/h2-3H,1H3,(H2,7,8,9)

SMILES: COC(=O)c1cnc[nH]c1=N

Synonyms:

• 5-Pyrimidinecarboxylic Acid, 4-Amino-, Methyl Ester
• Methyl 4-aminopyrimidine-5-carboxylate
• 5-Pyrimidinecarboxylicacid,4-amino-,methylester(9CI)

Methyl 4-aminopyrimidine-5-carboxylate

CAS: 714975-53-8

Formula: C₆H₇N₃O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 153.1387

Ref: IN-DA0066K8

Methyl 4-aminopyrimidine-5-carboxylate

CAS: 714975-53-8

Methyl 4-aminopyrimidine-5-carboxylate

Formula: C₆H₇N₃O₂

Purity: 98%

Color and Shape: yellow solid

Molecular weight: 153.14g/mol

Ref: 54-OR52896

Methyl 4-aminopyrimidine-5-carboxylate

CAS: 714975-53-8

Formula: C₆H₇N₃O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 153.141

Ref: 10-F077476