CAS 7150-04-1
:6-amino-5-bromo-1,3-dimethylpyrimidine-2,4(1H,3H)-dione
Description:
6-Amino-5-bromo-1,3-dimethylpyrimidine-2,4(1H,3H)-dione, with the CAS number 7150-04-1, is a heterocyclic organic compound belonging to the pyrimidine family. This compound features a pyrimidine ring substituted with an amino group at the 6-position and a bromo group at the 5-position, along with two methyl groups at the 1 and 3 positions. The presence of the dione functional groups at the 2 and 4 positions indicates that it has two carbonyl groups, contributing to its reactivity and potential as a building block in organic synthesis. The compound is typically characterized by its solid state at room temperature and may exhibit solubility in polar solvents due to the presence of the amino group. Its unique structure allows it to participate in various chemical reactions, making it of interest in medicinal chemistry and the development of pharmaceuticals. Additionally, the bromine substituent can facilitate further functionalization, enhancing its utility in synthetic applications.
Formula:C6H8BrN3O2
InChI:InChI=1/C6H8BrN3O2/c1-9-4(8)3(7)5(11)10(2)6(9)12/h8H2,1-2H3
SMILES:Cn1c(c(c(=O)n(C)c1=O)Br)N
Synonyms:- 2,4(1H,3H)-pyrimidinedione, 6-amino-5-bromo-1,3-dimethyl-
- 6-Amino-5-bromo-1,3-dimethyl-2,4(1H,3H)-pyrimidinedione
- 6-Amino-5-bromo-1,3-dimethylpyrimidine-2,4(1H,3H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.