CAS 7150-23-4

6-methoxypyridine-3-carboxamide

Description:

6-Methoxypyridine-3-carboxamide, with the CAS number 7150-23-4, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methoxy group (-OCH3) at the 6-position and a carboxamide group (-C(=O)NH2) at the 3-position of the pyridine ring. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and biological activity. As a carboxamide, it exhibits properties typical of amides, such as potential hydrogen bonding capabilities, which can affect its interactions in biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could contribute to various pharmacological activities. Additionally, it may serve as a building block in the synthesis of more complex molecules. Its stability, solubility, and reactivity can vary based on environmental conditions, making it a subject of interest in both synthetic and applied chemistry contexts.

Formula: C₇H₈N₂O₂

InChI: InChI=1/C7H8N2O2/c1-11-6-3-2-5(4-9-6)7(8)10/h2-4H,1H3,(H2,8,10)

SMILES: COc1ccc(cn1)C(=N)O

3-​Pyridinecarboxamide, 6-​methoxy-

CAS: 7150-23-4

Formula: C₇H₈N₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 152.1506

Ref: IN-DA003N9W

JBSNF-000088

CAS: 7150-23-4

JBSNF-000088

Purity: ≥98%

Molecular weight: 152.15g/mol

Ref: 54-BUP15116

6-Methoxynicotinamide

CAS: 7150-23-4

6-Methoxynicotinamide

Purity: 98%

Molecular weight: 152.15g/mol

Ref: 54-OR902093

JBSNF-000088

CAS: 7150-23-4

JBSNF-000088 is an Nicotinamide N-methyltransferase (NNMT)inhibitor. It is used for the treatment of metabolic disorders.

Formula: C₇H₈N₂O₂

Purity: 99.07% - 99.85%

Color and Shape: Solid

Molecular weight: 152.15

Ref: TM-T8106

6-Methoxynicotinamide

Controlled Product

CAS: 7150-23-4

Applications 6-Methoxynicotinamide

Formula: C₇H₈N₂O₂

Color and Shape: Neat

Molecular weight: 152.15

Ref: TR-M264928

6-Methoxynicotinamide

CAS: 7150-23-4

Formula: C₇H₈N₂O₂

Purity: 96%

Molecular weight: 152.153

Ref: 10-F209095