CymitQuimica logo

CAS 71501-08-1

:

Dipentylphenylphosphine

Description:
Dipentylphenylphosphine is an organophosphorus compound characterized by its phosphorus atom bonded to a phenyl group and two pentyl groups. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively low volatility. It exhibits good thermal stability and is soluble in organic solvents, making it useful in various chemical applications. Dipentylphenylphosphine can act as a ligand in coordination chemistry, particularly in catalysis and the formation of metal complexes. Its phosphorus atom can participate in various chemical reactions, including oxidation and coordination with transition metals. Additionally, it may exhibit properties such as moderate toxicity, necessitating careful handling and storage. The compound's unique structure allows it to be utilized in the synthesis of other organophosphorus compounds and in the development of materials with specific electronic or optical properties. Overall, dipentylphenylphosphine is a versatile compound with applications in both academic research and industrial processes.
Formula:C16H27P
InChI:InChI=1S/C16H27P/c1-3-5-10-14-17(15-11-6-4-2)16-12-8-7-9-13-16/h7-9,12-13H,3-6,10-11,14-15H2,1-2H3
InChI key:InChIKey=QDZAKCWPRPKCBW-UHFFFAOYSA-N
SMILES:P(CCCCC)(CCCCC)C1=CC=CC=C1
Synonyms:
  • Diamylphenyl phosphine
  • Dinamylphenylphosphine
  • Dipentyl(Phenyl)Phosphane
  • Dipentylphenylphosphine
  • Phosphine, dipentylphenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.