
CAS 71501-09-2
:Di-n-amyl L-tartrate
Description:
Di-n-amyl L-tartrate, with the CAS number 71501-09-2, is an organic compound that belongs to the class of tartrates, which are esters derived from tartaric acid. This substance is characterized by its chiral nature, as it contains a stereocenter, leading to potential optical activity. Di-n-amyl L-tartrate is typically a colorless to pale yellow liquid with a sweet, fruity odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water. This compound is often used as a chiral auxiliary in asymmetric synthesis, particularly in the production of pharmaceuticals and agrochemicals, due to its ability to influence the stereochemistry of reactions. Additionally, it may serve as a plasticizer in various polymer applications, enhancing flexibility and durability. Safety data indicates that while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed to minimize exposure.
Formula:C14H26O6
InChI:InChI=1S/C14H26O6/c1-3-5-7-9-19-13(17)11(15)12(16)14(18)20-10-8-6-4-2/h11-12,15-16H,3-10H2,1-2H3/t11-,12-/m1/s1
InChI key:InChIKey=CHNUEARJLWZWOD-VXGBXAGGSA-N
SMILES:[C@@H]([C@H](C(OCCCCC)=O)O)(C(OCCCCC)=O)O
Synonyms:- Dipentyl tartrate
- Butanedioic acid, 2,3-dihydroxy- [R-(R*,R*)]-, dipentyl ester
- Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, 1,4-dipentyl ester
- Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, dipentyl ester
- Dipentyl L-tartrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, 1,4-dipentyl ester
CAS:Formula:C14H26O6Molecular weight:290.3526
