CAS 71501-44-5
:1-(4-Chlorophenyl)cyclopentanecarbonyl chloride
Description:
1-(4-Chlorophenyl)cyclopentanecarbonyl chloride, with the CAS number 71501-44-5, is an organic compound characterized by its carbonyl chloride functional group attached to a cyclopentane ring and a para-chlorophenyl substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly as an acylating agent, which makes it useful in organic synthesis, especially in the preparation of amides and esters. The presence of the chlorophenyl group enhances its electrophilic character, facilitating nucleophilic attack. Additionally, the compound may exhibit moderate to high toxicity, necessitating careful handling and storage under appropriate safety protocols. Its solubility characteristics can vary, often being soluble in organic solvents while having limited solubility in water. As with many carbonyl compounds, it may undergo hydrolysis in the presence of moisture, leading to the formation of the corresponding acid. Overall, 1-(4-Chlorophenyl)cyclopentanecarbonyl chloride is a valuable intermediate in synthetic organic chemistry.
Formula:C12H12Cl2O
InChI:InChI=1S/C12H12Cl2O/c13-10-5-3-9(4-6-10)12(11(14)15)7-1-2-8-12/h3-6H,1-2,7-8H2
InChI key:InChIKey=RZHJJILZUKNEKM-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1(CCCC1)C2=CC=C(Cl)C=C2
Synonyms:- 1-(4-Chlorophenyl)-1-cyclopentanecarbonyl chloride
- 1-(4-Chlorophenyl)cyclopentanecarbonyl chloride
- Cyclopentanecarbonyl chloride, 1-(4-chlorophenyl)-
- Cyclopentanecarbonyl chloride, 1-(p-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
