
CAS 71501-51-4
:3′-Chloro-4′-methyl[1,1′-biphenyl]-2-carboxylic acid
Description:
3′-Chloro-4′-methyl[1,1′-biphenyl]-2-carboxylic acid, with the CAS number 71501-51-4, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid group (-COOH) at the 2-position contributes to its acidic properties, while the chloro and methyl substituents at the 3′ and 4′ positions, respectively, influence its reactivity and solubility. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties are affected by the electron-withdrawing nature of the chlorine atom and the electron-donating nature of the methyl group, which can impact its behavior in chemical reactions, such as electrophilic substitutions. Additionally, the compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and development. Safety data should be consulted for handling and usage guidelines.
Formula:C14H11ClO2
InChI:InChI=1S/C14H11ClO2/c1-9-6-7-10(8-13(9)15)11-4-2-3-5-12(11)14(16)17/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=DZPMRDTXTPOSDG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1)C2=CC(Cl)=C(C)C=C2
Synonyms:- [1,1′-Biphenyl]-2-carboxylic acid, 3′-chloro-4′-methyl-
- 3′-Chloro-4′-methyl[1,1′-biphenyl]-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.