CymitQuimica logo

CAS 71502-43-7

:

1-(3-Methylisoxazol-5-yl)ethanol

Description:
1-(3-Methylisoxazol-5-yl)ethanol, with the CAS number 71502-43-7, is an organic compound characterized by its isoxazole ring structure, which contributes to its unique chemical properties. This compound features a hydroxyl group (-OH) attached to an ethyl chain, making it an alcohol. The presence of the 3-methylisoxazole moiety imparts specific reactivity and potential biological activity, as isoxazoles are known for their roles in medicinal chemistry. The compound is likely to be a polar substance due to the hydroxyl group, which enhances its solubility in water and other polar solvents. Additionally, the isoxazole ring can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its structural characteristics suggest potential applications in pharmaceuticals or agrochemicals, where compounds with heterocyclic structures are often explored for their biological activities. Overall, 1-(3-Methylisoxazol-5-yl)ethanol is a compound of interest in organic synthesis and medicinal chemistry due to its unique structural features and potential functional properties.
Formula:C6H9NO2
InChI:InChI=1S/C6H9NO2/c1-4-3-6(5(2)8)9-7-4/h3,5,8H,1-2H3
InChI key:InChIKey=QLOCZOGQZFCJAZ-UHFFFAOYSA-N
SMILES:C(C)(O)C1=CC(C)=NO1
Synonyms:
  • α,3-Dimethyl-5-isoxazolemethanol
  • 1-(3-Methyl-1,2-oxazol-5-yl)ethanol
  • 1-(3-Methylisoxazol-5-yl)ethanol
  • 5-Isoxazolemethanol, α,3-dimethyl-
  • 1-(3-Methyl-1,2-oxazol-5-yl)ethan-1-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.