CAS 71510-41-3

2-(5-oxohexyl)isoindoline-1,3-dione

Description:

2-(5-oxohexyl)isoindoline-1,3-dione, with the CAS number 71510-41-3, is a chemical compound that belongs to the class of isoindoline derivatives. This substance features a bicyclic structure that includes an isoindoline core, characterized by a fused benzene and pyrrole ring system, along with a 5-oxohexyl substituent. The presence of the keto group (5-oxo) contributes to its reactivity and potential applications in organic synthesis. Typically, compounds of this nature exhibit properties such as moderate solubility in organic solvents and may participate in various chemical reactions, including nucleophilic additions and cycloadditions. The compound may also display biological activity, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, 2-(5-oxohexyl)isoindoline-1,3-dione represents a versatile scaffold for further chemical exploration and potential applications in pharmaceuticals or materials science.

Formula: C₁₄H₁₅NO₃

InChI: InChI=1/C14H15NO3/c1-10(16)6-4-5-9-15-13(17)11-7-2-3-8-12(11)14(15)18/h2-3,7-8H,4-6,9H2,1H3

SMILES: CC(=O)CCCCN1C(=O)c2ccccc2C1=O

Synonyms:

• 2-(5-Oxo-hexyl)-isoindole-1,3-dione

2-(5-Oxohexyl)-2,3-dihydro-1H-isoindole-1,3-dione

CAS: 71510-41-3

Versatile small molecule scaffold

Formula: C₁₄H₁₅NO₃

Purity: Min. 95%

Molecular weight: 245.27 g/mol

Ref: 3D-WCA51041