
CAS 71510-64-0
:4-[(Phenylmethyl)amino]butanenitrile
Description:
4-[(Phenylmethyl)amino]butanenitrile, with the CAS number 71510-64-0, is an organic compound characterized by its structure, which includes a butanenitrile backbone with a phenylmethylamino group attached. This compound typically exhibits properties common to nitriles, such as being polar and capable of forming hydrogen bonds due to the presence of the amino group. It is likely to be a solid at room temperature, with a relatively high melting point compared to non-polar compounds. The presence of both the nitrile and amino functional groups suggests potential reactivity, including nucleophilic substitution and the ability to participate in various organic reactions. Additionally, the phenylmethyl group may impart aromatic characteristics, influencing its solubility in organic solvents. This compound may find applications in pharmaceuticals or as an intermediate in organic synthesis, although specific uses would depend on its biological activity and reactivity profile. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C11H14N2
InChI:InChI=1S/C11H14N2/c12-8-4-5-9-13-10-11-6-2-1-3-7-11/h1-3,6-7,13H,4-5,9-10H2
InChI key:InChIKey=NZJWITSLFKTATC-UHFFFAOYSA-N
SMILES:C(NCCCC#N)C1=CC=CC=C1
Synonyms:- Butanenitrile, 4-[(phenylmethyl)amino]-
- 4-[(Phenylmethyl)amino]butanenitrile
- 4-(Benzylamino)butanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.