CymitQuimica logo

CAS 71510-95-7

:

Ethyl-N-methyl malonamide

Description:
Ethyl-N-methyl malonamide, with the CAS number 71510-95-7, is an organic compound characterized by its amide functional group and malonic acid derivative structure. It typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. This compound is known for its solubility in polar solvents, which makes it useful in various chemical applications. Ethyl-N-methyl malonamide exhibits moderate to low toxicity, and safety precautions should be taken when handling it, as with many organic chemicals. Its molecular structure includes ethyl and N-methyl groups, contributing to its unique reactivity and potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, it may participate in various chemical reactions, including condensation and substitution reactions, making it a versatile intermediate in synthetic chemistry. As with all chemical substances, proper handling, storage, and disposal according to safety guidelines are essential to minimize risks associated with its use.
Formula:C6H11NO3
InChI:InChI=1/C6H11NO3/c1-3-10-6(9)4-5(8)7-2/h3-4H2,1-2H3,(H,7,8)
InChI key:VWTRXRCWWIJCCQ-UHFFFAOYSA-N
SMILES:CCOC(=O)CC(=NC)O
Synonyms:
  • N-Methyl-malonamic acid ethyl ester
  • 3-(Methylamino)-3-oxo-propanoic acid ethyl ester
  • Ethyl 3-(Methylamino)-3-Oxopropanoate
Found 5 products.