
CAS 71510-96-8
:Ethyl 3-oxo-3-(propylamino)propanoate
Description:
Ethyl 3-oxo-3-(propylamino)propanoate, with the CAS number 71510-96-8, is an organic compound that belongs to the class of esters. It features a propanoate backbone, which is characterized by the presence of an ester functional group (-COO-) and a ketone group (C=O) adjacent to the ester. The compound contains a propylamino substituent, indicating the presence of a propyl group attached to an amino group (-NH2), which contributes to its reactivity and potential biological activity. Ethyl 3-oxo-3-(propylamino)propanoate is typically a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents and may exhibit moderate solubility in water. The compound can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it useful in synthetic organic chemistry. Its unique structure may also suggest potential applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its properties and biological activity.
Formula:C8H15NO3
InChI:InChI=1S/C8H15NO3/c1-3-5-9-7(10)6-8(11)12-4-2/h3-6H2,1-2H3,(H,9,10)
InChI key:InChIKey=BYHKMIIHUXAUBA-UHFFFAOYSA-N
SMILES:C(CC(OCC)=O)(NCCC)=O
Synonyms:- Propanoic acid, 3-oxo-3-(propylamino)-, ethyl ester
- Ethyl 3-oxo-3-(propylamino)propanoate
- 3-Oxo-3-(propylamino)Propanoic acid ethyl ester
- Ethyl N-propylmalonamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.