CymitQuimica logo

CAS 71511-38-1

:

7-fluorobenzo[pqr]tetraphene

Description:
7-Fluorobenzo[pqr]tetraphene is a polycyclic aromatic hydrocarbon characterized by its complex fused ring structure, which includes multiple benzene rings. The presence of a fluorine atom at the 7-position of the benzo[pqr]tetraphene framework introduces unique electronic and steric properties, potentially influencing its reactivity and interactions with other molecules. This compound is of interest in various fields, including materials science and organic electronics, due to its potential applications in organic semiconductors and light-emitting devices. Its photophysical properties, such as fluorescence and absorption spectra, may be altered by the fluorine substitution, making it a subject of study for understanding the effects of halogenation on aromatic systems. Additionally, the compound's stability and solubility can be affected by the fluorine atom, which may enhance its chemical robustness compared to its non-fluorinated counterparts. Overall, 7-fluorobenzo[pqr]tetraphene represents a fascinating example of how structural modifications can lead to significant changes in the properties of polycyclic aromatic hydrocarbons.
Formula:C20H11F
InChI:InChI=1/C20H11F/c21-18-6-2-5-15-16-10-9-13-4-1-3-12-7-8-14(11-17(15)18)20(16)19(12)13/h1-11H
SMILES:c1cc2ccc3cc4c(cccc4F)c4ccc(c1)c2c34
Synonyms:
  • Benzo[A]Pyrene, 7-Fluoro-
  • 7-Fluorobenzo[pqr]tetraphene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.