CAS 71516-68-2

1-(3,4-Dichlorophenyl)ethanone oxime

Description:

1-(3,4-Dichlorophenyl)ethanone oxime, with the CAS number 71516-68-2, is an organic compound characterized by its oxime functional group attached to a dichlorophenyl moiety. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including agrochemicals and pharmaceuticals. The presence of the dichlorophenyl group suggests that it may exhibit significant biological activity, potentially acting as a herbicide or pesticide. The oxime functional group, characterized by the presence of a nitrogen atom double-bonded to an oxygen atom and single-bonded to a carbon atom, can influence the compound's reactivity and stability. Additionally, the dichlorination of the phenyl ring can enhance lipophilicity, affecting the compound's solubility and interaction with biological systems. Safety data should be consulted for handling and exposure risks, as halogenated compounds can pose environmental and health hazards. Overall, 1-(3,4-Dichlorophenyl)ethanone oxime is a compound of interest in chemical research and application.

Formula: C₈H₇Cl₂NO

InChI: InChI=1/C8H7Cl2NO/c1-5(11-12)6-2-3-7(9)8(10)4-6/h2-4,12H,1H3

InChI key: InChIKey=LMETXBMWXOYVAN-UHFFFAOYSA-N

SMILES: C(=NO)(C)C1=CC(Cl)=C(Cl)C=C1

Synonyms:

• 1-(3,4-Dichlorophenyl)Ethanone Oxime
• 3′,4′-Dichloroacetophenone oxime
• Ethanone, 1-(3,4-dichlorophenyl)-, oxime
• 1-(3,4-Dichlorophenyl)ethan-1-one oxime

1-(3,4-dichlorophenyl)ethan-1-one oxime

CAS: 71516-68-2

1-(3,4-dichlorophenyl)ethan-1-one oxime

Purity: 95%

Molecular weight: 204.05328g/mol

Ref: 54-OR25531