CAS 71516-69-3

Ethanone, 1-(2,5-dichlorophenyl)-, oxime

Description:

Ethanone, 1-(2,5-dichlorophenyl)-, oxime, also known by its CAS number 71516-69-3, is an organic compound characterized by the presence of an oxime functional group attached to a substituted phenyl ring. This compound features a dichlorophenyl moiety, indicating that two chlorine atoms are substituted on the phenyl ring at the 2 and 5 positions, which can significantly influence its chemical reactivity and physical properties. Typically, oximes are known for their ability to form stable complexes with metal ions and can participate in various chemical reactions, including rearrangements and condensation reactions. The presence of the dichlorophenyl group may enhance the compound's lipophilicity and affect its solubility in organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in fields such as medicinal chemistry and agrochemicals. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental impact.

Formula: C₈H₇Cl₂NO

InChI: InChI=1S/C8H7Cl2NO/c1-5(11-12)7-4-6(9)2-3-8(7)10/h2-4,12H,1H3

InChI key: InChIKey=NGCAIVDLWOTIRL-UHFFFAOYSA-N

SMILES: C(=NO)(C)C1=C(Cl)C=CC(Cl)=C1

Synonyms:

• 1-(2,5-Dichloro-phenyl)-ethanone oxime
• Ethanone, 1-(2,5-dichlorophenyl)-, oxime
• 2′,5′-Dichloroacetophenone oxime
• Acetophenone, 2′,5′-dichloro-, oxime