CAS 7152-24-1
:2-(Methylthio)benzimidazole
Description:
2-(Methylthio)benzimidazole is an organic compound characterized by its benzimidazole core, which is a bicyclic structure consisting of a fused benzene and imidazole ring. The presence of a methylthio group (-S-CH3) at the second position of the benzimidazole ring imparts specific chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial or antifungal properties. The compound's molecular structure allows for interactions with biological targets, making it a candidate for further research in drug development. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2-(Methylthio)benzimidazole represents a versatile scaffold in organic synthesis and pharmaceutical applications.
Formula:C8H8N2S
InChI:InChI=1S/C8H8N2S/c1-11-8-9-6-4-2-3-5-7(6)10-8/h2-5H,1H3,(H,9,10)
InChI key:InChIKey=OCKJFOHZLXIAAT-UHFFFAOYSA-N
SMILES:S(C)C=1NC=2C(N1)=CC=CC2
Synonyms:- 1H-Benzimidazole, 2-(methylthio)-
- 2-(Methylsulfanyl)-1H-1,3-benzodiazole
- 2-(Methylsulfanyl)benzimidazole
- 2-(Methylthio)-1H-benzimidazole
- 2-(Methylthio)benzimidazole
- 2-(methylsulfanyl)-1H-benzimidazole
- 2-Methylmercaptobenzimidazole
- Benzimidazole, 2-(methylthio)-
- NSC 21699
- S-Methyl-2-mercaptobenzimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(Methylthio)benzimidazole
CAS:Formula:C8H8N2SPurity:>99.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:164.232-(Methylthio)-1H-benzo[d]imidazole
CAS:Formula:C8H8N2SPurity:98%Color and Shape:SolidMolecular weight:164.22752-(Methylthio)benzimidazole
CAS:Formula:C8H8N2SPurity:98%Color and Shape:SolidMolecular weight:164.232-(Methylthio)benzimidazole
CAS:2-(Methylthio)benzimidazole (MTBZ) is a diazonium salt that is used as a reagent for the introduction of the methylthio group into organic compounds. This reagent can be prepared by reacting sodium carbonate with trifluoroacetic acid in the presence of metal carbonyls to yield a reactive intermediate, which then reacts with diazonium salts. MTBZ is also known to inhibit cytochrome P450 enzymes and to inhibit bacterial growth in vitro. One application for MTBZ is in the synthesis of sulfoxides, benzimidazole compounds, and other heterocyclic compounds.Formula:C8H8N2SPurity:Min. 95%Molecular weight:164.23 g/mol





