CAS 7152-75-2
:4-(4-nitrobenzylidene)-2-phenyl-1,3-oxazol-5(4H)-one
Description:
4-(4-Nitrobenzylidene)-2-phenyl-1,3-oxazol-5(4H)-one, with the CAS number 7152-75-2, is an organic compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a nitro group and a benzylidene moiety, contributing to its potential reactivity and applications in organic synthesis. The presence of the phenyl group enhances its aromatic characteristics, which can influence its electronic properties and stability. Typically, compounds of this nature exhibit interesting photophysical properties, making them candidates for applications in materials science, such as in dyes or sensors. Additionally, the nitro group may impart specific chemical reactivity, allowing for further functionalization or use in various chemical reactions. The compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the presence of substituents, which can significantly affect its behavior in different environments. Overall, this compound represents a class of organic molecules with diverse potential applications in chemistry and materials science.
Formula:C16H10N2O4
InChI:InChI=1/C16H10N2O4/c19-16-14(10-11-6-8-13(9-7-11)18(20)21)17-15(22-16)12-4-2-1-3-5-12/h1-10H
SMILES:c1ccc(cc1)C1=NC(=Cc2ccc(cc2)N(=O)=O)C(=O)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.