
CAS 71522-58-2
:(αS)-α-Amino-3-hydroxy-4-(hydroxymethyl)benzeneacetic acid
Description:
(αS)-α-Amino-3-hydroxy-4-(hydroxymethyl)benzeneacetic acid, commonly known as a derivative of phenylalanine, is an amino acid characterized by its unique structural features. It contains an amino group (-NH2), a carboxylic acid group (-COOH), and multiple hydroxyl (-OH) groups, which contribute to its solubility in water and its potential for hydrogen bonding. The presence of the benzene ring in its structure imparts aromatic characteristics, influencing its reactivity and interaction with biological systems. This compound is often studied for its role in biochemical pathways and its potential applications in pharmaceuticals, particularly in the context of neurotransmitter synthesis and metabolic processes. Its stereochemistry, indicated by the (αS) designation, suggests specific spatial arrangements that can affect its biological activity and interactions with enzymes or receptors. Overall, this compound exemplifies the complexity of amino acid derivatives and their significance in both chemistry and biochemistry.
Formula:C9H11NO4
InChI:InChI=1S/C9H11NO4/c10-8(9(13)14)5-1-2-6(4-11)7(12)3-5/h1-3,8,11-12H,4,10H2,(H,13,14)/t8-/m0/s1
InChI key:InChIKey=JRBXPUUAYKCCLQ-QMMMGPOBSA-N
SMILES:[C@H](C(O)=O)(N)C1=CC(O)=C(CO)C=C1
Synonyms:- (2S)-amino[3-hydroxy-4-(hydroxymethyl)phenyl]ethanoic acid
- Forphenicinol
- (αS)-α-Amino-3-hydroxy-4-(hydroxymethyl)benzeneacetic acid
- Benzeneacetic acid, α-amino-3-hydroxy-4-(hydroxymethyl)-, (αS)-
- BF 121
- (-)-(R)-alpha-Amino-3-hydroxy-4-(hydroxymethyl)benzeneacetic acid
- Benzeneacetic acid, α-amino-3-hydroxy-4-(hydroxymethyl)-, (S)-
- Forfenimex
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Forfenimex
CAS:Forfenimex is a newly discovered low molecular weight immunomodulator.Formula:C9H11NO4Color and Shape:SolidMolecular weight:197.19
